C24H33NO — CID 170752367
3-[7-methyl-1-(2-phenylethyl)azepan-3-yl]phenol;prop-1-ene (PubChem CID 170752367) has the molecular formula C24H33NO and a molecular weight of 351.53 g/mol. Its IUPAC name is 3-[7-methyl-1-(2-phenylethyl)azepan-3-yl]phenol;prop-1-ene.
| Compound Name | 3-[7-methyl-1-(2-phenylethyl)azepan-3-yl]phenol;prop-1-ene |
|---|---|
| PubChem CID | 170752367 |
| Molecular Formula | C24H33NO |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 3-[7-methyl-1-(2-phenylethyl)azepan-3-yl]phenol;prop-1-ene |
| SMILES | C=CC.CC1CCCC(c2cccc(O)c2)CN1CCc1ccccc1 |
| InChI | InChI=1S/C21H27NO.C3H6/c1-17-7-5-11-20(19-10-6-12-21(23)15-19)16-22(17)14-13-18-8-3-2-4-9-18;1-3-2/h2-4,6,8-10,12,15,17,20,23H,5,7,11,13-14,16H2,1H3;3H,1H2,2H3 |
| InChIKey | SDHFXIXZOFQWFW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|