C8H13N3O2 — CID 170755518
6-formyl-2,6-diazaspiro[3.4]octane-8-carboxamide (PubChem CID 170755518) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 6-formyl-2,6-diazaspiro[3.4]octane-8-carboxamide.
| Compound Name | 6-formyl-2,6-diazaspiro[3.4]octane-8-carboxamide |
|---|---|
| PubChem CID | 170755518 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 6-formyl-2,6-diazaspiro[3.4]octane-8-carboxamide |
| SMILES | NC(=O)C1CN(C=O)CC12CNC2 |
| InChI | InChI=1S/C8H13N3O2/c9-7(13)6-1-11(5-12)4-8(6)2-10-3-8/h5-6,10H,1-4H2,(H2,9,13) |
| InChIKey | KHEXHZHQYQIXNC-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|