C20H20Cl2F4N4O2 — CID 170756428
1-[5-[5-[(3,4-dichlorophenyl)-difluoromethyl]-1,3,4-oxadiazol-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]-3,3-difluoro-2,2-dimethylpropan-1-one (PubChem CID 170756428) has the molecular formula C20H20Cl2F4N4O2 and a molecular weight of 495.30 g/mol. Its IUPAC name is 1-[5-[5-[(3,4-dichlorophenyl)-difluoromethyl]-1,3,4-oxadiazol-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]-3,3-difluoro-2,2-dimethylpropan-1-one.
| Compound Name | 1-[5-[5-[(3,4-dichlorophenyl)-difluoromethyl]-1,3,4-oxadiazol-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]-3,3-difluoro-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 170756428 |
| Molecular Formula | C20H20Cl2F4N4O2 |
| Molecular Weight | 495.30 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 1-[5-[5-[(3,4-dichlorophenyl)-difluoromethyl]-1,3,4-oxadiazol-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]-3,3-difluoro-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C(=O)N1CC2(CNCC2c2nnc(C(F)(F)c3ccc(Cl)c(Cl)c3)o2)C1)C(F)F |
| InChI | InChI=1S/C20H20Cl2F4N4O2/c1-18(2,15(23)24)17(31)30-8-19(9-30)7-27-6-11(19)14-28-29-16(32-14)20(25,26)10-3-4-12(21)13(22)5-10/h3-5,11,15,27H,6-9H2,1-2H3 |
| InChIKey | ZQIDDMFFAYZLAV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |