C23H24Cl2F2N4O3 — CID 170756043
1-[5-[5-[(3,4-dichlorophenyl)-difluoromethyl]-1,3,4-oxadiazol-2-yl]-2-[(1S)-2,2-dimethylcyclopropanecarbonyl]-2,7-diazaspiro[3.4]octan-7-yl]ethanone (PubChem CID 170756043) has the molecular formula C23H24Cl2F2N4O3 and a molecular weight of 513.37 g/mol. Its IUPAC name is 1-[5-[5-[(3,4-dichlorophenyl)-difluoromethyl]-1,3,4-oxadiazol-2-yl]-2-[(1S)-2,2-dimethylcyclopropanecarbonyl]-2,7-diazaspiro[3.4]octan-7-yl]ethanone.
| Compound Name | 1-[5-[5-[(3,4-dichlorophenyl)-difluoromethyl]-1,3,4-oxadiazol-2-yl]-2-[(1S)-2,2-dimethylcyclopropanecarbonyl]-2,7-diazaspiro[3.4]octan-7-yl]ethanone |
|---|---|
| PubChem CID | 170756043 |
| Molecular Formula | C23H24Cl2F2N4O3 |
| Molecular Weight | 513.37 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 1-[5-[5-[(3,4-dichlorophenyl)-difluoromethyl]-1,3,4-oxadiazol-2-yl]-2-[(1S)-2,2-dimethylcyclopropanecarbonyl]-2,7-diazaspiro[3.4]octan-7-yl]ethanone |
| SMILES | CC(=O)N1CC(c2nnc(C(F)(F)c3ccc(Cl)c(Cl)c3)o2)C2(C1)CN(C(=O)[C@H]1CC1(C)C)C2 |
| InChI | InChI=1S/C23H24Cl2F2N4O3/c1-12(32)30-8-15(22(9-30)10-31(11-22)19(33)14-7-21(14,2)3)18-28-29-20(34-18)23(26,27)13-4-5-16(24)17(25)6-13/h4-6,14-15H,7-11H2,1-3H3/t14-,15?/m1/s1 |
| InChIKey | IINOPHCTTVHSSV-GICMACPYSA-N |
| XLogP | 4.34 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |