C14H29N3O7 — CID 170759237
ethane;2-formamido-3-methoxy-N-methylbutanamide;methyl 2-formamido-3-hydroxypropanoate (PubChem CID 170759237) has the molecular formula C14H29N3O7 and a molecular weight of 351.40 g/mol. Its IUPAC name is ethane;2-formamido-3-methoxy-N-methylbutanamide;methyl 2-formamido-3-hydroxypropanoate.
| Compound Name | ethane;2-formamido-3-methoxy-N-methylbutanamide;methyl 2-formamido-3-hydroxypropanoate |
|---|---|
| PubChem CID | 170759237 |
| Molecular Formula | C14H29N3O7 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | ethane;2-formamido-3-methoxy-N-methylbutanamide;methyl 2-formamido-3-hydroxypropanoate |
| SMILES | CC.CNC(=O)C(NC=O)C(C)OC.COC(=O)C(CO)NC=O |
| InChI | InChI=1S/C7H14N2O3.C5H9NO4.C2H6/c1-5(12-3)6(9-4-10)7(11)8-2;1-10-5(9)4(2-7)6-3-8;1-2/h4-6H,1-3H3,(H,8,11)(H,9,10);3-4,7H,2H2,1H3,(H,6,8);1-2H3 |
| InChIKey | NDEMWPVUHQBJQN-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|