C14H26N2O5 — CID 170956290
methyl 2-formamido-5-[(6-hydroxy-5-methylhexyl)amino]-5-oxopentanoate (PubChem CID 170956290) has the molecular formula C14H26N2O5 and a molecular weight of 302.37 g/mol. Its IUPAC name is methyl 2-formamido-5-[(6-hydroxy-5-methylhexyl)amino]-5-oxopentanoate.
| Compound Name | methyl 2-formamido-5-[(6-hydroxy-5-methylhexyl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 170956290 |
| Molecular Formula | C14H26N2O5 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | methyl 2-formamido-5-[(6-hydroxy-5-methylhexyl)amino]-5-oxopentanoate |
| SMILES | COC(=O)C(CCC(=O)NCCCCC(C)CO)NC=O |
| InChI | InChI=1S/C14H26N2O5/c1-11(9-17)5-3-4-8-15-13(19)7-6-12(16-10-18)14(20)21-2/h10-12,17H,3-9H2,1-2H3,(H,15,19)(H,16,18) |
| InChIKey | SWECWCKOZRXPQO-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|