C20H19F4NO4S — CID 170761035
[2-[(4-cyclohexylphenyl)carbamoyl]-4-fluorophenyl] trifluoromethanesulfonate (PubChem CID 170761035) has the molecular formula C20H19F4NO4S and a molecular weight of 445.43 g/mol. Its IUPAC name is [2-[(4-cyclohexylphenyl)carbamoyl]-4-fluorophenyl] trifluoromethanesulfonate.
| Compound Name | [2-[(4-cyclohexylphenyl)carbamoyl]-4-fluorophenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 170761035 |
| Molecular Formula | C20H19F4NO4S |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | [2-[(4-cyclohexylphenyl)carbamoyl]-4-fluorophenyl] trifluoromethanesulfonate |
| SMILES | O=C(Nc1ccc(C2CCCCC2)cc1)c1cc(F)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H19F4NO4S/c21-15-8-11-18(29-30(27,28)20(22,23)24)17(12-15)19(26)25-16-9-6-14(7-10-16)13-4-2-1-3-5-13/h6-13H,1-5H2,(H,25,26) |
| InChIKey | WFVDRPWXBYQOQK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|