C20H19ClFNO3 — CID 147616775
2-chloro-5-[(4-cyclohexylphenyl)carbamoyl]-3-fluorobenzoic acid (PubChem CID 147616775) has the molecular formula C20H19ClFNO3 and a molecular weight of 375.83 g/mol. Its IUPAC name is 2-chloro-5-[(4-cyclohexylphenyl)carbamoyl]-3-fluorobenzoic acid.
| Compound Name | 2-chloro-5-[(4-cyclohexylphenyl)carbamoyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 147616775 |
| Molecular Formula | C20H19ClFNO3 |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-chloro-5-[(4-cyclohexylphenyl)carbamoyl]-3-fluorobenzoic acid |
| SMILES | O=C(Nc1ccc(C2CCCCC2)cc1)c1cc(F)c(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H19ClFNO3/c21-18-16(20(25)26)10-14(11-17(18)22)19(24)23-15-8-6-13(7-9-15)12-4-2-1-3-5-12/h6-12H,1-5H2,(H,23,24)(H,25,26) |
| InChIKey | GDBSSPUUIJJMQA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |