C8H10N2OS — CID 170761979
4-cyanothiophene-2-carboxamide;ethane (PubChem CID 170761979) has the molecular formula C8H10N2OS and a molecular weight of 182.25 g/mol. Its IUPAC name is 4-cyanothiophene-2-carboxamide;ethane.
| Compound Name | 4-cyanothiophene-2-carboxamide;ethane |
|---|---|
| PubChem CID | 170761979 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 4-cyanothiophene-2-carboxamide;ethane |
| SMILES | CC.N#Cc1csc(C(N)=O)c1 |
| InChI | InChI=1S/C6H4N2OS.C2H6/c7-2-4-1-5(6(8)9)10-3-4;1-2/h1,3H,(H2,8,9);1-2H3 |
| InChIKey | GVQNZCWYHJHSBG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |