C25H22N4O2 — CID 170762149
1-[(3R)-3-[[4-(3-phenyl-1H-pyrrolo[3,2-b]pyridin-2-yl)-3-pyridinyl]oxy]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 170762149) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 1-[(3R)-3-[[4-(3-phenyl-1H-pyrrolo[3,2-b]pyridin-2-yl)-3-pyridinyl]oxy]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[[4-(3-phenyl-1H-pyrrolo[3,2-b]pyridin-2-yl)-3-pyridinyl]oxy]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170762149 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 1-[(3R)-3-[[4-(3-phenyl-1H-pyrrolo[3,2-b]pyridin-2-yl)-3-pyridinyl]oxy]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](Oc2cnccc2-c2[nH]c3cccnc3c2-c2ccccc2)C1 |
| InChI | InChI=1S/C25H22N4O2/c1-2-22(30)29-14-11-18(16-29)31-21-15-26-13-10-19(21)24-23(17-7-4-3-5-8-17)25-20(28-24)9-6-12-27-25/h2-10,12-13,15,18,28H,1,11,14,16H2/t18-/m1/s1 |
| InChIKey | HYDSVRNVGOQCGM-GOSISDBHSA-N |
| XLogP | 4.46 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|