C12H16N2O3 — CID 170769157
2-cyclobutyloxy-N,N-dimethyl-5-nitroaniline (PubChem CID 170769157) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-cyclobutyloxy-N,N-dimethyl-5-nitroaniline.
| Compound Name | 2-cyclobutyloxy-N,N-dimethyl-5-nitroaniline |
|---|---|
| PubChem CID | 170769157 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-cyclobutyloxy-N,N-dimethyl-5-nitroaniline |
| SMILES | CN(C)c1cc([N+](=O)[O-])ccc1OC1CCC1 |
| InChI | InChI=1S/C12H16N2O3/c1-13(2)11-8-9(14(15)16)6-7-12(11)17-10-4-3-5-10/h6-8,10H,3-5H2,1-2H3 |
| InChIKey | ZKPBUBLPGDSRCE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|