C27H38N4O10S2 — CID 158974603
N-(2-cyclohexyloxy-4-nitrophenyl)methanesulfonamide;N-(2-cyclohexyloxy-4-nitrophenyl)-N-methylmethanesulfonamide (PubChem CID 158974603) has the molecular formula C27H38N4O10S2 and a molecular weight of 642.75 g/mol. Its IUPAC name is N-(2-cyclohexyloxy-4-nitrophenyl)methanesulfonamide;N-(2-cyclohexyloxy-4-nitrophenyl)-N-methylmethanesulfonamide.
| Compound Name | N-(2-cyclohexyloxy-4-nitrophenyl)methanesulfonamide;N-(2-cyclohexyloxy-4-nitrophenyl)-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 158974603 |
| Molecular Formula | C27H38N4O10S2 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.20 |
| IUPAC Name | N-(2-cyclohexyloxy-4-nitrophenyl)methanesulfonamide;N-(2-cyclohexyloxy-4-nitrophenyl)-N-methylmethanesulfonamide |
| SMILES | CN(c1ccc([N+](=O)[O-])cc1OC1CCCCC1)S(C)(=O)=O.CS(=O)(=O)Nc1ccc([N+](=O)[O-])cc1OC1CCCCC1 |
| InChI | InChI=1S/C14H20N2O5S.C13H18N2O5S/c1-15(22(2,19)20)13-9-8-11(16(17)18)10-14(13)21-12-6-4-3-5-7-12;1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11/h8-10,12H,3-7H2,1-2H3;7-9,11,14H,2-6H2,1H3 |
| InChIKey | JOFQAUWFVMAEFA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 188.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|