C13H15F3N2O5S — CID 14771324
N-(2-cyclohexyloxy-4-nitrophenyl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 14771324) has the molecular formula C13H15F3N2O5S and a molecular weight of 368.33 g/mol. Its IUPAC name is N-(2-cyclohexyloxy-4-nitrophenyl)-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-(2-cyclohexyloxy-4-nitrophenyl)-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 14771324 |
| Molecular Formula | C13H15F3N2O5S |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N-(2-cyclohexyloxy-4-nitrophenyl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(NS(=O)(=O)C(F)(F)F)c(OC2CCCCC2)c1 |
| InChI | InChI=1S/C13H15F3N2O5S/c14-13(15,16)24(21,22)17-11-7-6-9(18(19)20)8-12(11)23-10-4-2-1-3-5-10/h6-8,10,17H,1-5H2 |
| InChIKey | UOOGMFNBOWUBDO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|