C14H20N2O5S — CID 14771311
N-[2-[(1R,2S)-2-methylcyclohexyl]oxy-4-nitrophenyl]methanesulfonamide (PubChem CID 14771311) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is N-[2-[(1R,2S)-2-methylcyclohexyl]oxy-4-nitrophenyl]methanesulfonamide.
| Compound Name | N-[2-[(1R,2S)-2-methylcyclohexyl]oxy-4-nitrophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 14771311 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-[2-[(1R,2S)-2-methylcyclohexyl]oxy-4-nitrophenyl]methanesulfonamide |
| SMILES | C[C@H]1CCCC[C@H]1Oc1cc([N+](=O)[O-])ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C14H20N2O5S/c1-10-5-3-4-6-13(10)21-14-9-11(16(17)18)7-8-12(14)15-22(2,19)20/h7-10,13,15H,3-6H2,1-2H3/t10-,13+/m0/s1 |
| InChIKey | NCBXWTIZBLOYBP-GXFFZTMASA-N |
| XLogP | 2.92 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|