C13H18N2NaO5S — CID 67863952
sodium N-(2-cyclohexyloxy-4-nitrophenyl)methanesulfonamide (PubChem CID 67863952) has the molecular formula C13H18N2NaO5S and a molecular weight of 337.35 g/mol.
| Compound Name | sodium N-(2-cyclohexyloxy-4-nitrophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 67863952 |
| Molecular Formula | C13H18N2NaO5S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)Nc1ccc([N+](=O)[O-])cc1OC1CCCCC1.[Na] |
| InChI | InChI=1S/C13H18N2O5S.Na/c1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11;/h7-9,11,14H,2-6H2,1H3; |
| InChIKey | RRYWLWKPSBTOOC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|