C11H22N2O4S — CID 170770363
(2S)-2-amino-4-[3-(3-methyloxetan-3-yl)propylsulfonimidoyl]butanoic acid (PubChem CID 170770363) has the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. Its IUPAC name is (2S)-2-amino-4-[3-(3-methyloxetan-3-yl)propylsulfonimidoyl]butanoic acid.
| Compound Name | (2S)-2-amino-4-[3-(3-methyloxetan-3-yl)propylsulfonimidoyl]butanoic acid |
|---|---|
| PubChem CID | 170770363 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (2S)-2-amino-4-[3-(3-methyloxetan-3-yl)propylsulfonimidoyl]butanoic acid |
| SMILES | [H]N=S(=O)(CCCC1(C)COC1)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C11H22N2O4S/c1-11(7-17-8-11)4-2-5-18(13,16)6-3-9(12)10(14)15/h9,13H,2-8,12H2,1H3,(H,14,15)/t9-,18?/m0/s1 |
| InChIKey | IVVJUHNYZYXESZ-JUGYALQGSA-N |
| XLogP | 0.65 |
| TPSA | 113.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |