C24H29Cl2F3N2O4S — CID 170770482
butyl 2-amino-4-[[3-[4-(2,4-dichlorophenyl)phenyl]-4,4,4-trifluoro-3-hydroxybutyl]sulfonimidoyl]butanoate (PubChem CID 170770482) has the molecular formula C24H29Cl2F3N2O4S and a molecular weight of 569.47 g/mol. Its IUPAC name is butyl 2-amino-4-[[3-[4-(2,4-dichlorophenyl)phenyl]-4,4,4-trifluoro-3-hydroxybutyl]sulfonimidoyl]butanoate.
| Compound Name | butyl 2-amino-4-[[3-[4-(2,4-dichlorophenyl)phenyl]-4,4,4-trifluoro-3-hydroxybutyl]sulfonimidoyl]butanoate |
|---|---|
| PubChem CID | 170770482 |
| Molecular Formula | C24H29Cl2F3N2O4S |
| Molecular Weight | 569.47 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | butyl 2-amino-4-[[3-[4-(2,4-dichlorophenyl)phenyl]-4,4,4-trifluoro-3-hydroxybutyl]sulfonimidoyl]butanoate |
| SMILES | [H]N=S(=O)(CCC(N)C(=O)OCCCC)CCC(O)(c1ccc(-c2ccc(Cl)cc2Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C24H29Cl2F3N2O4S/c1-2-3-12-35-22(32)21(30)10-13-36(31,34)14-11-23(33,24(27,28)29)17-6-4-16(5-7-17)19-9-8-18(25)15-20(19)26/h4-9,15,21,31,33H,2-3,10-14,30H2,1H3 |
| InChIKey | RIASVGFVEZHSPP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 113.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|