C16H23NO4S — CID 170770497
2-amino-4-[2-(5-ethoxycarbonyl-2-methylphenyl)ethylsulfanyl]butanoic acid (PubChem CID 170770497) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is 2-amino-4-[2-(5-ethoxycarbonyl-2-methylphenyl)ethylsulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[2-(5-ethoxycarbonyl-2-methylphenyl)ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 170770497 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-amino-4-[2-(5-ethoxycarbonyl-2-methylphenyl)ethylsulfanyl]butanoic acid |
| SMILES | CCOC(=O)c1ccc(C)c(CCSCCC(N)C(=O)O)c1 |
| InChI | InChI=1S/C16H23NO4S/c1-3-21-16(20)13-5-4-11(2)12(10-13)6-8-22-9-7-14(17)15(18)19/h4-5,10,14H,3,6-9,17H2,1-2H3,(H,18,19) |
| InChIKey | XGTAOSNIYZMJCN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|