C21H27Cl2NO3 — CID 170771215
2-(2,4-dichlorophenoxy)-N-phenylmethoxyacetamide;methane;(Z)-pent-2-ene (PubChem CID 170771215) has the molecular formula C21H27Cl2NO3 and a molecular weight of 412.36 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-phenylmethoxyacetamide;methane;(Z)-pent-2-ene.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-phenylmethoxyacetamide;methane;(Z)-pent-2-ene |
|---|---|
| PubChem CID | 170771215 |
| Molecular Formula | C21H27Cl2NO3 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-phenylmethoxyacetamide;methane;(Z)-pent-2-ene |
| SMILES | C.C/C=C\CC.O=C(COc1ccc(Cl)cc1Cl)NOCc1ccccc1 |
| InChI | InChI=1S/C15H13Cl2NO3.C5H10.CH4/c16-12-6-7-14(13(17)8-12)20-10-15(19)18-21-9-11-4-2-1-3-5-11;1-3-5-4-2;/h1-8H,9-10H2,(H,18,19);3,5H,4H2,1-2H3;1H4/b;5-3-; |
| InChIKey | LCGUQLZQDYLWGP-FMFSYIAASA-N |
| XLogP | 6.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|