C25H22N4O3S — CID 170773622
2-[3-[(E)-2-(benzylideneamino)ethenyl]-2,4-dioxo-1H-thieno[3,2-d]pyrimidin-6-yl]-4-methoxybenzonitrile;ethane (PubChem CID 170773622) has the molecular formula C25H22N4O3S and a molecular weight of 458.54 g/mol. Its IUPAC name is 2-[3-[(E)-2-(benzylideneamino)ethenyl]-2,4-dioxo-1H-thieno[3,2-d]pyrimidin-6-yl]-4-methoxybenzonitrile;ethane.
| Compound Name | 2-[3-[(E)-2-(benzylideneamino)ethenyl]-2,4-dioxo-1H-thieno[3,2-d]pyrimidin-6-yl]-4-methoxybenzonitrile;ethane |
|---|---|
| PubChem CID | 170773622 |
| Molecular Formula | C25H22N4O3S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 2-[3-[(E)-2-(benzylideneamino)ethenyl]-2,4-dioxo-1H-thieno[3,2-d]pyrimidin-6-yl]-4-methoxybenzonitrile;ethane |
| SMILES | CC.COc1ccc(C#N)c(-c2cc3[nH]c(=O)n(/C=C/N=C/c4ccccc4)c(=O)c3s2)c1 |
| InChI | InChI=1S/C23H16N4O3S.C2H6/c1-30-17-8-7-16(13-24)18(11-17)20-12-19-21(31-20)22(28)27(23(29)26-19)10-9-25-14-15-5-3-2-4-6-15;1-2/h2-12,14H,1H3,(H,26,29);1-2H3/b10-9+,25-14+; |
| InChIKey | WTYGPRQIUGTLFI-LBLFGNNMSA-N |
| XLogP | 4.87 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|