C19H24N2OS2 — CID 17077587
7-tert-butyl-2-(3-methylthiophen-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 17077587) has the molecular formula C19H24N2OS2 and a molecular weight of 360.55 g/mol. Its IUPAC name is 7-tert-butyl-2-(3-methylthiophen-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-tert-butyl-2-(3-methylthiophen-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 17077587 |
| Molecular Formula | C19H24N2OS2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 7-tert-butyl-2-(3-methylthiophen-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccsc1C1NC(=O)c2c(sc3c2CCC(C(C)(C)C)C3)N1 |
| InChI | InChI=1S/C19H24N2OS2/c1-10-7-8-23-15(10)16-20-17(22)14-12-6-5-11(19(2,3)4)9-13(12)24-18(14)21-16/h7-8,11,16,21H,5-6,9H2,1-4H3,(H,20,22) |
| InChIKey | PCGHFDXJXCEHJA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |