C24H29N3OS — CID 4272215
7-tert-butyl-2-(1,2-dimethylindol-3-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 4272215) has the molecular formula C24H29N3OS and a molecular weight of 407.58 g/mol. Its IUPAC name is 7-tert-butyl-2-(1,2-dimethylindol-3-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-tert-butyl-2-(1,2-dimethylindol-3-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4272215 |
| Molecular Formula | C24H29N3OS |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 7-tert-butyl-2-(1,2-dimethylindol-3-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1c(C2NC(=O)c3c(sc4c3CCC(C(C)(C)C)C4)N2)c2ccccc2n1C |
| InChI | InChI=1S/C24H29N3OS/c1-13-19(15-8-6-7-9-17(15)27(13)5)21-25-22(28)20-16-11-10-14(24(2,3)4)12-18(16)29-23(20)26-21/h6-9,14,21,26H,10-12H2,1-5H3,(H,25,28) |
| InChIKey | QIBIRLHEBQQGBA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|