C53H48N2 — CID 170779988
(3R)-4-N'-(3,5,7,9,9-pentamethylfluoren-2-yl)-4-N,4-N,4-N'-triphenyl-3,3'-spirobi[1,2-dihydroindene]-4,4'-diamine (PubChem CID 170779988) has the molecular formula C53H48N2 and a molecular weight of 712.98 g/mol. Its IUPAC name is (3R)-4-N'-(3,5,7,9,9-pentamethylfluoren-2-yl)-4-N,4-N,4-N'-triphenyl-3,3'-spirobi[1,2-dihydroindene]-4,4'-diamine.
| Compound Name | (3R)-4-N'-(3,5,7,9,9-pentamethylfluoren-2-yl)-4-N,4-N,4-N'-triphenyl-3,3'-spirobi[1,2-dihydroindene]-4,4'-diamine |
|---|---|
| PubChem CID | 170779988 |
| Molecular Formula | C53H48N2 |
| Molecular Weight | 712.98 g/mol |
| Exact Mass | 712.38 |
| IUPAC Name | (3R)-4-N'-(3,5,7,9,9-pentamethylfluoren-2-yl)-4-N,4-N,4-N'-triphenyl-3,3'-spirobi[1,2-dihydroindene]-4,4'-diamine |
| SMILES | Cc1cc(C)c2c(c1)C(C)(C)c1cc(N(c3ccccc3)c3cccc4c3[C@]3(CCc5cccc(N(c6ccccc6)c6ccccc6)c53)CC4)c(C)cc1-2 |
| InChI | InChI=1S/C53H48N2/c1-35-31-37(3)49-43-33-36(2)48(34-44(43)52(4,5)45(49)32-35)55(42-23-13-8-14-24-42)47-26-16-18-39-28-30-53(51(39)47)29-27-38-17-15-25-46(50(38)53)54(40-19-9-6-10-20-40)41-21-11-7-12-22-41/h6-26,31-34H,27-30H2,1-5H3/t53-/m1/s1 |
| InChIKey | ALWBHGAALILMAV-IONAWPRUSA-N |
| XLogP | 14.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.98 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |