C37H52N6O10 — CID 170781647
methyl (4S)-5-[2-[4-[[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]amino]phenyl]ethylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (PubChem CID 170781647) has the molecular formula C37H52N6O10 and a molecular weight of 740.86 g/mol. Its IUPAC name is methyl (4S)-5-[2-[4-[[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]amino]phenyl]ethylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate.
| Compound Name | methyl (4S)-5-[2-[4-[[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]amino]phenyl]ethylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 170781647 |
| Molecular Formula | C37H52N6O10 |
| Molecular Weight | 740.86 g/mol |
| Exact Mass | 740.37 |
| IUPAC Name | methyl (4S)-5-[2-[4-[[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]amino]phenyl]ethylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| SMILES | COC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)NCCc1ccc(NC(=O)c2ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C37H52N6O10/c1-35(2,3)51-32(47)41-27(19-20-28(44)50-10)30(46)38-22-21-23-11-15-25(16-12-23)39-29(45)24-13-17-26(18-14-24)40-31(42-33(48)52-36(4,5)6)43-34(49)53-37(7,8)9/h11-18,27H,19-22H2,1-10H3,(H,38,46)(H,39,45)(H,41,47)(H2,40,42,43,48,49)/t27-/m0/s1 |
| InChIKey | TUIISZHMAFTHOP-MHZLTWQESA-N |
| XLogP | 5.48 |
| TPSA | 211.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.86 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|