C10H6F3NO — CID 170786805
3,3,4-trifluoro-4H-1-benzazepin-2-one (PubChem CID 170786805) has the molecular formula C10H6F3NO and a molecular weight of 213.16 g/mol. Its IUPAC name is 3,3,4-trifluoro-4H-1-benzazepin-2-one.
| Compound Name | 3,3,4-trifluoro-4H-1-benzazepin-2-one |
|---|---|
| PubChem CID | 170786805 |
| Molecular Formula | C10H6F3NO |
| Molecular Weight | 213.16 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 3,3,4-trifluoro-4H-1-benzazepin-2-one |
| SMILES | O=C1N=c2ccccc2=CC(F)C1(F)F |
| InChI | InChI=1S/C10H6F3NO/c11-8-5-6-3-1-2-4-7(6)14-9(15)10(8,12)13/h1-5,8H |
| InChIKey | AXSMLEWDEMWKBX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |