C11H7F3N2O — CID 19771752
3-(2,2,2-trifluoroethyl)-1,4-benzodiazepin-2-one (PubChem CID 19771752) has the molecular formula C11H7F3N2O and a molecular weight of 240.18 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethyl)-1,4-benzodiazepin-2-one.
| Compound Name | 3-(2,2,2-trifluoroethyl)-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 19771752 |
| Molecular Formula | C11H7F3N2O |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 3-(2,2,2-trifluoroethyl)-1,4-benzodiazepin-2-one |
| SMILES | O=c1nc2ccccc2cnc1CC(F)(F)F |
| InChI | InChI=1S/C11H7F3N2O/c12-11(13,14)5-9-10(17)16-8-4-2-1-3-7(8)6-15-9/h1-4,6H,5H2 |
| InChIKey | YCKKAIJMYSUZNR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |