C30H26FN3O2 — CID 170789374
3-[(2S)-1-cyclopropylidenepropan-2-yl]-5-(1-dibenzofuran-2-ylethylamino)-2-(2-fluorophenyl)pyrimidin-4-one (PubChem CID 170789374) has the molecular formula C30H26FN3O2 and a molecular weight of 479.56 g/mol. Its IUPAC name is 3-[(2S)-1-cyclopropylidenepropan-2-yl]-5-(1-dibenzofuran-2-ylethylamino)-2-(2-fluorophenyl)pyrimidin-4-one.
| Compound Name | 3-[(2S)-1-cyclopropylidenepropan-2-yl]-5-(1-dibenzofuran-2-ylethylamino)-2-(2-fluorophenyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 170789374 |
| Molecular Formula | C30H26FN3O2 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 3-[(2S)-1-cyclopropylidenepropan-2-yl]-5-(1-dibenzofuran-2-ylethylamino)-2-(2-fluorophenyl)pyrimidin-4-one |
| SMILES | CC(Nc1cnc(-c2ccccc2F)n([C@@H](C)C=C2CC2)c1=O)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C30H26FN3O2/c1-18(15-20-11-12-20)34-29(23-8-3-5-9-25(23)31)32-17-26(30(34)35)33-19(2)21-13-14-28-24(16-21)22-7-4-6-10-27(22)36-28/h3-10,13-19,33H,11-12H2,1-2H3/t18-,19?/m0/s1 |
| InChIKey | LUWRHTGIEXSDBV-OYKVQYDMSA-N |
| XLogP | 7.40 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|