C17H23N3O3 — CID 170789392
2-(5-amino-6-oxo-2-phenylpyrimidin-1-yl)acetaldehyde;2-methoxy-2-methylpropane (PubChem CID 170789392) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-(5-amino-6-oxo-2-phenylpyrimidin-1-yl)acetaldehyde;2-methoxy-2-methylpropane.
| Compound Name | 2-(5-amino-6-oxo-2-phenylpyrimidin-1-yl)acetaldehyde;2-methoxy-2-methylpropane |
|---|---|
| PubChem CID | 170789392 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-(5-amino-6-oxo-2-phenylpyrimidin-1-yl)acetaldehyde;2-methoxy-2-methylpropane |
| SMILES | COC(C)(C)C.Nc1cnc(-c2ccccc2)n(CC=O)c1=O |
| InChI | InChI=1S/C12H11N3O2.C5H12O/c13-10-8-14-11(9-4-2-1-3-5-9)15(6-7-16)12(10)17;1-5(2,3)6-4/h1-5,7-8H,6,13H2;1-4H3 |
| InChIKey | PWZKLKMGDNZVQJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|