C9H11N3 — CID 170799104
4-(3,5-dimethyl-1H-pyrazol-4-yl)but-3-enenitrile (PubChem CID 170799104) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 4-(3,5-dimethyl-1H-pyrazol-4-yl)but-3-enenitrile.
| Compound Name | 4-(3,5-dimethyl-1H-pyrazol-4-yl)but-3-enenitrile |
|---|---|
| PubChem CID | 170799104 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 4-(3,5-dimethyl-1H-pyrazol-4-yl)but-3-enenitrile |
| SMILES | Cc1n[nH]c(C)c1C=CCC#N |
| InChI | InChI=1S/C9H11N3/c1-7-9(5-3-4-6-10)8(2)12-11-7/h3,5H,4H2,1-2H3,(H,11,12) |
| InChIKey | FOAPZBKIQGSJDY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |