C6H7N3O3S — CID 82076458
3,5-dimethyl-N-(oxomethylidene)-1H-pyrazole-4-sulfonamide (PubChem CID 82076458) has the molecular formula C6H7N3O3S and a molecular weight of 201.21 g/mol. Its IUPAC name is 3,5-dimethyl-N-(oxomethylidene)-1H-pyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-(oxomethylidene)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 82076458 |
| Molecular Formula | C6H7N3O3S |
| Molecular Weight | 201.21 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 3,5-dimethyl-N-(oxomethylidene)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N=C=O |
| InChI | InChI=1S/C6H7N3O3S/c1-4-6(5(2)9-8-4)13(11,12)7-3-10/h1-2H3,(H,8,9) |
| InChIKey | FJCHFDAEVGWSAV-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 92.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.21 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|