C24H37BO3 — CID 170802324
3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol (PubChem CID 170802324) has the molecular formula C24H37BO3 and a molecular weight of 384.37 g/mol. Its IUPAC name is 3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol.
| Compound Name | 3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 170802324 |
| Molecular Formula | C24H37BO3 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
| SMILES | Cc1cc2c(cc1C=C(CO)B1OC(C)(C)C(C)(C)O1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H37BO3/c1-16-12-19-20(22(4,5)11-10-21(19,2)3)14-17(16)13-18(15-26)25-27-23(6,7)24(8,9)28-25/h12-14,26H,10-11,15H2,1-9H3 |
| InChIKey | UQSCIPWDOUDFDS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|