C25H23N3O3 — CID 17080362
N'-(2-indol-1-ylacetyl)-2-(4-phenylphenoxy)propanehydrazide (PubChem CID 17080362) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is N'-(2-indol-1-ylacetyl)-2-(4-phenylphenoxy)propanehydrazide.
| Compound Name | N'-(2-indol-1-ylacetyl)-2-(4-phenylphenoxy)propanehydrazide |
|---|---|
| PubChem CID | 17080362 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N'-(2-indol-1-ylacetyl)-2-(4-phenylphenoxy)propanehydrazide |
| SMILES | CC(Oc1ccc(-c2ccccc2)cc1)C(=O)NNC(=O)Cn1ccc2ccccc21 |
| InChI | InChI=1S/C25H23N3O3/c1-18(31-22-13-11-20(12-14-22)19-7-3-2-4-8-19)25(30)27-26-24(29)17-28-16-15-21-9-5-6-10-23(21)28/h2-16,18H,17H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | PLBNUFIQZJAHQG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|