C7H12N2O2S — CID 170819275
1-(5-methyl-1H-pyrazol-4-yl)-3-sulfanylpropane-1,2-diol (PubChem CID 170819275) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is 1-(5-methyl-1H-pyrazol-4-yl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(5-methyl-1H-pyrazol-4-yl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170819275 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 1-(5-methyl-1H-pyrazol-4-yl)-3-sulfanylpropane-1,2-diol |
| SMILES | Cc1[nH]ncc1C(O)C(O)CS |
| InChI | InChI=1S/C7H12N2O2S/c1-4-5(2-8-9-4)7(11)6(10)3-12/h2,6-7,10-12H,3H2,1H3,(H,8,9) |
| InChIKey | VJKJECJELSPTKL-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|