C12H17NO2S — CID 170820097
3-sulfanyl-1-(1,2,3,4-tetrahydroisoquinolin-5-yl)propane-1,2-diol (PubChem CID 170820097) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 3-sulfanyl-1-(1,2,3,4-tetrahydroisoquinolin-5-yl)propane-1,2-diol.
| Compound Name | 3-sulfanyl-1-(1,2,3,4-tetrahydroisoquinolin-5-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 170820097 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 3-sulfanyl-1-(1,2,3,4-tetrahydroisoquinolin-5-yl)propane-1,2-diol |
| SMILES | OC(CS)C(O)c1cccc2c1CCNC2 |
| InChI | InChI=1S/C12H17NO2S/c14-11(7-16)12(15)10-3-1-2-8-6-13-5-4-9(8)10/h1-3,11-16H,4-7H2 |
| InChIKey | ITIFRXNBSZWLAZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|