About S-[3-(3-amino-1-methylpyrazol-4-yl)-2,3-dihydroxypropyl] ethanethioate
S-[3-(3-amino-1-methylpyrazol-4-yl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170821449) has the molecular formula C9H15N3O3S
and a molecular weight of 245.30 g/mol. Its IUPAC name is S-[3-(3-amino-1-methylpyrazol-4-yl)-2,3-dihydroxypropyl] ethanethioate.
Molecular Properties
| Compound Name | S-[3-(3-amino-1-methylpyrazol-4-yl)-2,3-dihydroxypropyl] ethanethioate |
| PubChem CID | 170821449 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | S-[3-(3-amino-1-methylpyrazol-4-yl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cn(C)nc1N |
| InChI | InChI=1S/C9H15N3O3S/c1-5(13)16-4-7(14)8(15)6-3-12(2)11-9(6)10/h3,7-8,14-15H,4H2,1-2H3,(H2,10,11) |
| InChIKey | IRTDXGFLPYDJBW-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[3-(3-amino-1-methylpyrazol-4-yl)-2,3-dihydroxypropyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[3-(3-amino-1-methylpyrazol-4-yl)-2,3-dihydroxypropyl] ethanethioate?
The IUPAC name of S-[3-(3-amino-1-methylpyrazol-4-yl)-2,3-dihydroxypropyl] ethanethioate (CID 170821449) is S-[3-(3-amino-1-methylpyrazol-4-yl)-2,3-dihydroxypropyl] ethanethioate.
What is the SMILES notation for S-[3-(3-amino-1-methylpyrazol-4-yl)-2,3-dihydroxypropyl] ethanethioate?
The canonical SMILES for S-[3-(3-amino-1-methylpyrazol-4-yl)-2,3-dihydroxypropyl] ethanethioate is CC(=O)SCC(O)C(O)c1cn(C)nc1N.
What is the InChIKey of S-[3-(3-amino-1-methylpyrazol-4-yl)-2,3-dihydroxypropyl] ethanethioate?
The InChIKey is IRTDXGFLPYDJBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3S/c1-5(13)16-4-7(14)8(15)6-3-12(2)11-9(6)10/h3,7-8,14-15H,4H2,1-2H3,(H2,10,11).
What are the key properties of S-[3-(3-amino-1-methylpyrazol-4-yl)-2,3-dihydroxypropyl] ethanethioate?
S-[3-(3-amino-1-methylpyrazol-4-yl)-2,3-dihydroxypropyl] ethanethioate has a molecular weight of 245.30 g/mol, XLogP of -0.32, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for S-[3-(3-amino-1-methylpyrazol-4-yl)-2,3-dihydroxypropyl] ethanethioate is sourced from PubChem (CID 170821449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).