C11H15NO5S2 — CID 170822368
ethyl 5-(3-acetylsulfanyl-1,2-dihydroxypropyl)-1,3-thiazole-4-carboxylate (PubChem CID 170822368) has the molecular formula C11H15NO5S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is ethyl 5-(3-acetylsulfanyl-1,2-dihydroxypropyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-(3-acetylsulfanyl-1,2-dihydroxypropyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 170822368 |
| Molecular Formula | C11H15NO5S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | ethyl 5-(3-acetylsulfanyl-1,2-dihydroxypropyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncsc1C(O)C(O)CSC(C)=O |
| InChI | InChI=1S/C11H15NO5S2/c1-3-17-11(16)8-10(19-5-12-8)9(15)7(14)4-18-6(2)13/h5,7,9,14-15H,3-4H2,1-2H3 |
| InChIKey | PGUBSWRFLTUOPF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|