C9H14N2O3S2 — CID 170821376
S-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170821376) has the molecular formula C9H14N2O3S2 and a molecular weight of 262.36 g/mol. Its IUPAC name is S-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170821376 |
| Molecular Formula | C9H14N2O3S2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | S-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1sc(N)nc1C |
| InChI | InChI=1S/C9H14N2O3S2/c1-4-8(16-9(10)11-4)7(14)6(13)3-15-5(2)12/h6-7,13-14H,3H2,1-2H3,(H2,10,11) |
| InChIKey | AOFOYEOOWVVOLM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|