C14H20N4O2 — CID 170826844
3-azido-1-[3-(pyrrolidin-1-ylmethyl)phenyl]propane-1,2-diol (PubChem CID 170826844) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-azido-1-[3-(pyrrolidin-1-ylmethyl)phenyl]propane-1,2-diol.
| Compound Name | 3-azido-1-[3-(pyrrolidin-1-ylmethyl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 170826844 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-azido-1-[3-(pyrrolidin-1-ylmethyl)phenyl]propane-1,2-diol |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1cccc(CN2CCCC2)c1 |
| InChI | InChI=1S/C14H20N4O2/c15-17-16-9-13(19)14(20)12-5-3-4-11(8-12)10-18-6-1-2-7-18/h3-5,8,13-14,19-20H,1-2,6-7,9-10H2 |
| InChIKey | APHUYTHIEJMRAC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 92.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|