C14H17N5O2 — CID 170826996
3-azido-1-[3-(3,5-dimethylpyrazol-1-yl)phenyl]propane-1,2-diol (PubChem CID 170826996) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 3-azido-1-[3-(3,5-dimethylpyrazol-1-yl)phenyl]propane-1,2-diol.
| Compound Name | 3-azido-1-[3-(3,5-dimethylpyrazol-1-yl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 170826996 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 3-azido-1-[3-(3,5-dimethylpyrazol-1-yl)phenyl]propane-1,2-diol |
| SMILES | Cc1cc(C)n(-c2cccc(C(O)C(O)CN=[N+]=[N-])c2)n1 |
| InChI | InChI=1S/C14H17N5O2/c1-9-6-10(2)19(17-9)12-5-3-4-11(7-12)14(21)13(20)8-16-18-15/h3-7,13-14,20-21H,8H2,1-2H3 |
| InChIKey | SWNXSOLBELKIJK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|