C15H17FN4O2 — CID 170827413
3-azido-1-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]propane-1,2-diol (PubChem CID 170827413) has the molecular formula C15H17FN4O2 and a molecular weight of 304.33 g/mol. Its IUPAC name is 3-azido-1-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]propane-1,2-diol.
| Compound Name | 3-azido-1-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 170827413 |
| Molecular Formula | C15H17FN4O2 |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-azido-1-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]propane-1,2-diol |
| SMILES | Cc1cc(C(O)C(O)CN=[N+]=[N-])c(C)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C15H17FN4O2/c1-9-6-13(15(22)14(21)8-18-19-17)10(2)20(9)12-5-3-4-11(16)7-12/h3-7,14-15,21-22H,8H2,1-2H3 |
| InChIKey | HMFXPSZGDLKIIY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|