C15H19NO3 — CID 170819208
1-(2,5-dimethyl-1-phenylpyrrol-3-yl)propane-1,2,3-triol (PubChem CID 170819208) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)propane-1,2,3-triol.
| Compound Name | 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170819208 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)propane-1,2,3-triol |
| SMILES | Cc1cc(C(O)C(O)CO)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C15H19NO3/c1-10-8-13(15(19)14(18)9-17)11(2)16(10)12-6-4-3-5-7-12/h3-8,14-15,17-19H,9H2,1-2H3 |
| InChIKey | YURUVVFXGIPZLW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|