C30H30N2O4 — CID 170835559
9H-fluoren-9-ylmethyl N-[3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170835559) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170835559 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2,3-dihydroxypropyl]carbamate |
| SMILES | Cc1cc(C(O)C(O)CNC(=O)OCC2c3ccccc3-c3ccccc32)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C30H30N2O4/c1-19-16-26(20(2)32(19)21-10-4-3-5-11-21)29(34)28(33)17-31-30(35)36-18-27-24-14-8-6-12-22(24)23-13-7-9-15-25(23)27/h3-16,27-29,33-34H,17-18H2,1-2H3,(H,31,35) |
| InChIKey | QPQMKZZCVICIBK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|