C33H34N2O6 — CID 170835564
ethyl 4-[3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 170835564) has the molecular formula C33H34N2O6 and a molecular weight of 554.64 g/mol. Its IUPAC name is ethyl 4-[3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 170835564 |
| Molecular Formula | C33H34N2O6 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | ethyl 4-[3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(C)cc(C(O)C(O)CNC(=O)OCC3c4ccccc4-c4ccccc43)c2C)cc1 |
| InChI | InChI=1S/C33H34N2O6/c1-4-40-32(38)22-13-15-23(16-14-22)35-20(2)17-28(21(35)3)31(37)30(36)18-34-33(39)41-19-29-26-11-7-5-9-24(26)25-10-6-8-12-27(25)29/h5-17,29-31,36-37H,4,18-19H2,1-3H3,(H,34,39) |
| InChIKey | DZZMABRVGNBFFO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|