C38H32N2O4 — CID 170835560
9H-fluoren-9-ylmethyl N-[3-(1,2-diphenylindol-3-yl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170835560) has the molecular formula C38H32N2O4 and a molecular weight of 580.68 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(1,2-diphenylindol-3-yl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(1,2-diphenylindol-3-yl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170835560 |
| Molecular Formula | C38H32N2O4 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(1,2-diphenylindol-3-yl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1c(-c2ccccc2)n(-c2ccccc2)c2ccccc12)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C38H32N2O4/c41-34(23-39-38(43)44-24-32-29-19-9-7-17-27(29)28-18-8-10-20-30(28)32)37(42)35-31-21-11-12-22-33(31)40(26-15-5-2-6-16-26)36(35)25-13-3-1-4-14-25/h1-22,32,34,37,41-42H,23-24H2,(H,39,43) |
| InChIKey | FPCHDJVFNGJKKJ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |