C15H16Cl3NO2 — CID 171863421
3-chloro-1-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]propane-1,2-diol (PubChem CID 171863421) has the molecular formula C15H16Cl3NO2 and a molecular weight of 348.66 g/mol. Its IUPAC name is 3-chloro-1-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]propane-1,2-diol.
| Compound Name | 3-chloro-1-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 171863421 |
| Molecular Formula | C15H16Cl3NO2 |
| Molecular Weight | 348.66 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 3-chloro-1-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]propane-1,2-diol |
| SMILES | Cc1cc(C(O)C(O)CCl)c(C)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H16Cl3NO2/c1-8-6-10(15(21)13(20)7-16)9(2)19(8)12-5-3-4-11(17)14(12)18/h3-6,13,15,20-21H,7H2,1-2H3 |
| InChIKey | YVQLNIIPIGBQHW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.66 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|