C15H17Cl2NO2S — CID 170821266
1-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-3-sulfanylpropane-1,2-diol (PubChem CID 170821266) has the molecular formula C15H17Cl2NO2S and a molecular weight of 346.28 g/mol. Its IUPAC name is 1-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170821266 |
| Molecular Formula | C15H17Cl2NO2S |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 1-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-3-sulfanylpropane-1,2-diol |
| SMILES | Cc1cc(C(O)C(O)CS)c(C)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H17Cl2NO2S/c1-8-6-10(15(20)13(19)7-21)9(2)18(8)12-5-3-4-11(16)14(12)17/h3-6,13,15,19-21H,7H2,1-2H3 |
| InChIKey | IDOCLWFCDPMICE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|