C16H21FN2O — CID 139319154
2-(dimethylamino)-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanol (PubChem CID 139319154) has the molecular formula C16H21FN2O and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-(dimethylamino)-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanol.
| Compound Name | 2-(dimethylamino)-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanol |
|---|---|
| PubChem CID | 139319154 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-(dimethylamino)-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanol |
| SMILES | Cc1cc(C(O)CN(C)C)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H21FN2O/c1-11-9-15(16(20)10-18(3)4)12(2)19(11)14-7-5-13(17)6-8-14/h5-9,16,20H,10H2,1-4H3 |
| InChIKey | DICFLZMEZBMLMH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|