C10H9ClF2O3 — CID 170836550
1-chloro-3-[2-(difluoromethoxy)-4-hydroxyphenyl]propan-2-one (PubChem CID 170836550) has the molecular formula C10H9ClF2O3 and a molecular weight of 250.63 g/mol. Its IUPAC name is 1-chloro-3-[2-(difluoromethoxy)-4-hydroxyphenyl]propan-2-one.
| Compound Name | 1-chloro-3-[2-(difluoromethoxy)-4-hydroxyphenyl]propan-2-one |
|---|---|
| PubChem CID | 170836550 |
| Molecular Formula | C10H9ClF2O3 |
| Molecular Weight | 250.63 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 1-chloro-3-[2-(difluoromethoxy)-4-hydroxyphenyl]propan-2-one |
| SMILES | O=C(CCl)Cc1ccc(O)cc1OC(F)F |
| InChI | InChI=1S/C10H9ClF2O3/c11-5-8(15)3-6-1-2-7(14)4-9(6)16-10(12)13/h1-2,4,10,14H,3,5H2 |
| InChIKey | GTSOFTQOPWPNLF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.63 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|