C11H11BrN2O — CID 170838828
3-bromo-N,1-dimethylindole-6-carboxamide (PubChem CID 170838828) has the molecular formula C11H11BrN2O and a molecular weight of 267.13 g/mol. Its IUPAC name is 3-bromo-N,1-dimethylindole-6-carboxamide.
| Compound Name | 3-bromo-N,1-dimethylindole-6-carboxamide |
|---|---|
| PubChem CID | 170838828 |
| Molecular Formula | C11H11BrN2O |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 3-bromo-N,1-dimethylindole-6-carboxamide |
| SMILES | CNC(=O)c1ccc2c(Br)cn(C)c2c1 |
| InChI | InChI=1S/C11H11BrN2O/c1-13-11(15)7-3-4-8-9(12)6-14(2)10(8)5-7/h3-6H,1-2H3,(H,13,15) |
| InChIKey | MGRFHUXWCVTMNG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |