C10H7Cl2N3O — CID 118460869
1,4-dichloro-N-methylphthalazine-6-carboxamide (PubChem CID 118460869) has the molecular formula C10H7Cl2N3O and a molecular weight of 256.09 g/mol. Its IUPAC name is 1,4-dichloro-N-methylphthalazine-6-carboxamide.
| Compound Name | 1,4-dichloro-N-methylphthalazine-6-carboxamide |
|---|---|
| PubChem CID | 118460869 |
| Molecular Formula | C10H7Cl2N3O |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | 1,4-dichloro-N-methylphthalazine-6-carboxamide |
| SMILES | CNC(=O)c1ccc2c(Cl)nnc(Cl)c2c1 |
| InChI | InChI=1S/C10H7Cl2N3O/c1-13-10(16)5-2-3-6-7(4-5)9(12)15-14-8(6)11/h2-4H,1H3,(H,13,16) |
| InChIKey | CXPMGLGPERHTLM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |